2'-Deoxyuridine-5,6-D2 is a deuterium-labeled derivative of 2'-deoxyuridine used as a research reagent. The compound incorporates two deuterium atoms at the 5 and 6 positions of the uracil ring, making it valuable for stable isotope tracer studies in biochemical research.
2'-Deoxyuridine-5,6-D2 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2'-Deoxyuridine-5,6-D2 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Bromo(2-~2~H)propane
Deuterated research compound
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
5,6-dideuterio-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione
MXHRCPNRJAMMIM-AQAQJVFASA-N
[2H]C1=C(N(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O)[2H]