안전 참조
경고
H319Causes serious eye irritation
1,3-Dioxolan-2-one-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,3-Dioxolan-2-one-d4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-Chlorophenylmagnesium bromide
Grignard reagent for organic synthesis
1,3-Dioxolan-2-one-d4 is a deuterated research compound, specifically a tetradeuterated form of ethylene carbonate, used as a labeled reagent in chemical and biological studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4,4,5,5-tetradeuterio-1,3-dioxolan-2-one
KMTRUDSVKNLOMY-LNLMKGTHSA-N
[2H]C1(C(OC(=O)O1)([2H])[2H])[2H]