안전 참조
경고
H302Harmful if swallowed
H315Causes skin irritation
H319Causes serious eye irritation
H335May cause respiratory irritation
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Pharmaceutical intermediate for synthesis
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
This compound is a pharmaceutical intermediate used in the manufacturing of active pharmaceutical ingredients. It features an aromatic ring and multiple amine functional groups, contributing to its chemical reactivity and potential for further synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-(4-aminophenyl)-N-methyl-2-(4-methylpiperazin-1-yl)acetamide
LBWNQLVDYPNHAV-UHFFFAOYSA-N
CN1CCN(CC1)CC(=O)N(C)C2=CC=C(C=C2)N