(+)-Lysergide-d10 is a deuterated analytical standard used in quantitative mass spectrometry and forensic toxicology. Its structure incorporates ten deuterium atoms, providing an internal standard for the detection and quantification of lysergic acid diethylamide (LSD) in biological matrices.
(+)-Lysergide-d10 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(+)-Lysergide-d10 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Sulfamerazine D4
Deuterated research standard
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(6aR,9R)-7-methyl-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide
VAYOSLLFUXYJDT-ABGPMOFUSA-N
[2H]C([2H])([2H])C([2H])([2H])N(C(=O)[C@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)C)C([2H])([2H])C([2H])([2H])[2H]