안전 참조
위험
H290May be corrosive to metals
H314Causes severe skin burns and eye damage
H315Causes skin irritation
H318
Diethylenetriamine pentamethylene phosphonic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
BHTPMP
Anti-scaling agent
Diethylenetriamine pentamethylene phosphonic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Diethylenetriamine pentamethylene phosphonic acid is a highly polar, water-soluble organic compound containing multiple phosphonic acid groups and amine functionalities. Its flexible structure and high chelating potential make it relevant for industrial applications where metal ion sequestration is required.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Diethylenetriamine pentamethylene phosphonic acid(CAS 15827-60-8)의 국제 HS 코드는 2931.49입니다.
2931.49
2931 49 40
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
[bis[2-[bis(phosphonomethyl)amino]ethyl]amino]methylphosphonic acid
DUYCTCQXNHFCSJ-UHFFFAOYSA-N
C(CN(CP(=O)(O)O)CP(=O)(O)O)N(CCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O