안전 참조
위험
H334May cause allergy or asthma symptoms or breathing difficulties if inhaled
H400Very toxic to aquatic life
H411Toxic to aquatic life with long lasting effects
Ertapenem sodium 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ertapenem N-Carbonyl Dimer Impurity
Pharmaceutical impurity reference standard
Ertapenem sodium 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ertapenem sodium is the sodium salt of ertapenem, a broad-spectrum beta-lactam antibiotic of the carbapenem class. It acts by binding to penicillin-binding proteins on the bacterial cell wall, inhibiting peptidoglycan synthesis and leading to bacterial cell death.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
sodium 3-[[(2S,4S)-4-[[(4R,5S,6S)-2-carboxy-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-en-3-yl]sulfanyl]pyrrolidine-2-carbonyl]amino]benzoate
ZXNAQFZBWUNWJM-HRXMHBOMSA-M
C[C@@H]1[C@@H]2[C@H](C(=O)N2C(=C1S[C@H]3C[C@H](NC3)C(=O)NC4=CC=CC(=C4)C(=O)[O-])C(=O)O)[C@@H](C)O.[Na+]