2-(Methyl-d3)-aniline is a deuterium-labeled research reagent. It is an aniline derivative with three deuterium atoms substituted on the methyl group, commonly used in analytical and pharmaceutical research for tracing or metabolic studies.
2-(Methyl-d3)-aniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
PIPERAZINE-2,2,3,3,5,5,6,6-D8
Deuterated research reagent
(2H7)Aniline
Deuterated research reagent
4-Bromoanisole-2,3,5,6-d4
Deuterated research reagent
3-Picoline-d7
Deuterated research reagent
2-Hydroxyphenylthiourea
research compound
Perylene, perdeutero-
deuterated reference standard
23-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3,6,9,12,15,18,21-heptaoxatricosanoic acid
PEGylated Fmoc-protected amino acid reagent
3-Fluoropyridine-2-carboxylic acid
research compound
2-(Methyl-d3)-aniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-(trideuteriomethyl)aniline
RNVCVTLRINQCPJ-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=CC=C1N