안전 참조
위험
H317May cause an allergic skin reaction
H334May cause allergy or asthma symptoms or breathing difficulties if inhaled
Reactive Yellow 15 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
C.I. Reactive Violet 1
reactive dye for textiles
Reactive Yellow 15 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Reactive Yellow 15 is a synthetic azo dye used as a reactive dye for textile fibers, particularly cotton. Its molecular structure contains multiple sulfonate groups and an azo linkage, contributing to its water solubility and ability to form covalent bonds with cellulose.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
disodium;4-[4-[[2-methoxy-5-methyl-4-(2-sulfonatooxyethylsulfonyl)phenyl]diazenyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzenesulfonate
XHNGUZQWLVRGBP-UHFFFAOYSA-L
CC1=CC(=C(C=C1S(=O)(=O)CCOS(=O)(=O)[O-])OC)N=NC2=C(NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C.[Na+].[Na+]