4-N-Butylaniline-D15 is a deuterated research reagent, specifically a fully deuterated analog of 4-n-butylaniline where all hydrogen atoms are replaced with deuterium. This compound is primarily used in analytical and biochemical studies where isotopic labeling is required to trace or quantify chemical pathways.
4-N-BUTYLANILINE-D15 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-N-BUTYLANILINE-D15 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
3-nitrobenzyl-d6 alcohol
stable isotope labeled research compound
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N,N,2,3,5,6-hexadeuterio-4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)aniline
OGIQUQKNJJTLSZ-RRFMZHHTSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])[2H])[2H])N([2H])[2H])[2H]