안전 참조
위험
H301Toxic if swallowed
H311Toxic in contact with skin
H314Causes severe skin burns and eye damage
H401Toxic to aquatic life
4-(2H3)methylphenol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-(2H3)methylphenol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ethyl paraben-d4
deuterated internal standard
4-(2H3)Methylphenol is a deuterated internal standard used primarily in analytical chemistry and mass spectrometry. It serves as a stable isotope-labeled reference compound for quantifying p-cresol in biological and environmental samples.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-(trideuteriomethyl)phenol
IWDCLRJOBJJRNH-FIBGUPNXSA-N
[2H]C([2H])([2H])C1=CC=C(C=C1)O