This compound is a deuterium-labeled derivative of a piperidine-based building block, specifically tert-butyl 4-oxopiperidine-1-carboxylate. It is used as a research reagent, primarily in life science and chemical studies where isotopic labeling aids in tracking or mechanistic investigations.
1-Boc-4-PIPERIDONE-2,2,6,6-D4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Boc-4-PIPERIDONE-2,2,6,6-D4 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Dihexyl phthalate-3,4,5,6-d4
isotope labeled internal standard
1-Methyl-4-piperidone-2,2,6,6-d4
deuterated research reference standard
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
tert-butyl 2,2,6,6-tetradeuterio-4-oxopiperidine-1-carboxylate
ROUYFJUVMYHXFJ-KXGHAPEVSA-N
[2H]C1(CC(=O)CC(N1C(=O)OC(C)(C)C)([2H])[2H])[2H]